C23H21ClFN3O3S — CID 158445800
4-[3-chloro-2-fluoro-4-(2-pyrrolidin-1-yl-2-sulfanylideneethyl)phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 158445800) has the molecular formula C23H21ClFN3O3S and a molecular weight of 473.96 g/mol. Its IUPAC name is 4-[3-chloro-2-fluoro-4-(2-pyrrolidin-1-yl-2-sulfanylideneethyl)phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-2-fluoro-4-(2-pyrrolidin-1-yl-2-sulfanylideneethyl)phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 158445800 |
| Molecular Formula | C23H21ClFN3O3S |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 4-[3-chloro-2-fluoro-4-(2-pyrrolidin-1-yl-2-sulfanylideneethyl)phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=S)N4CCCC4)c(Cl)c3F)c2cc1C(N)=O |
| InChI | InChI=1S/C23H21ClFN3O3S/c1-30-19-12-16-14(11-15(19)23(26)29)17(6-7-27-16)31-18-5-4-13(21(24)22(18)25)10-20(32)28-8-2-3-9-28/h4-7,11-12H,2-3,8-10H2,1H3,(H2,26,29) |
| InChIKey | KZNGWFXSQYQXFI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|