About 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol
2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol (PubChem CID 158446153) has the molecular formula C11H29N3O2
and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol |
| PubChem CID | 158446153 |
| Molecular Formula | C11H29N3O2 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol |
| SMILES | CN(C)C.CN(C)CCO.CN1CC(O)C1 |
| InChI | InChI=1S/C4H9NO.C4H11NO.C3H9N/c1-5-2-4(6)3-5;1-5(2)3-4-6;1-4(2)3/h4,6H,2-3H2,1H3;6H,3-4H2,1-2H3;1-3H3 |
| InChIKey | HDKNOYQZTMFOBI-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol?
The IUPAC name of 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol (CID 158446153) is 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol.
What is the SMILES notation for 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol?
The canonical SMILES for 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol is CN(C)C.CN(C)CCO.CN1CC(O)C1.
What is the InChIKey of 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol?
The InChIKey is HDKNOYQZTMFOBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C4H11NO.C3H9N/c1-5-2-4(6)3-5;1-5(2)3-4-6;1-4(2)3/h4,6H,2-3H2,1H3;6H,3-4H2,1-2H3;1-3H3.
What are the key properties of 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol?
2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol has a molecular weight of 235.37 g/mol, XLogP of -0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethanol;N,N-dimethylmethanamine;1-methylazetidin-3-ol is sourced from PubChem (CID 158446153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).