About heptane;methyl-nonyl-ditritiosilane
heptane;methyl-nonyl-ditritiosilane (PubChem CID 158446190) has the molecular formula C17H40Si
and a molecular weight of 276.61 g/mol. Its IUPAC name is heptane;methyl-nonyl-ditritiosilane.
Molecular Properties
| Compound Name | heptane;methyl-nonyl-ditritiosilane |
| PubChem CID | 158446190 |
| Molecular Formula | C17H40Si |
| Molecular Weight | 276.61 g/mol |
| Exact Mass | 276.31 |
| IUPAC Name | heptane;methyl-nonyl-ditritiosilane |
| SMILES | CCCCCCC.[3H][Si]([3H])(C)CCCCCCCCC |
| InChI | InChI=1S/C10H24Si.C7H16/c1-3-4-5-6-7-8-9-10-11-2;1-3-5-7-6-4-2/h3-11H2,1-2H3;3-7H2,1-2H3/i11T2; |
| InChIKey | HDKPWSNOJGDARA-HOHXVFBJSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze heptane;methyl-nonyl-ditritiosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;methyl-nonyl-ditritiosilane?
The IUPAC name of heptane;methyl-nonyl-ditritiosilane (CID 158446190) is heptane;methyl-nonyl-ditritiosilane.
What is the SMILES notation for heptane;methyl-nonyl-ditritiosilane?
The canonical SMILES for heptane;methyl-nonyl-ditritiosilane is CCCCCCC.[3H][Si]([3H])(C)CCCCCCCCC.
What is the InChIKey of heptane;methyl-nonyl-ditritiosilane?
The InChIKey is HDKPWSNOJGDARA-HOHXVFBJSA-N. The full InChI is InChI=1S/C10H24Si.C7H16/c1-3-4-5-6-7-8-9-10-11-2;1-3-5-7-6-4-2/h3-11H2,1-2H3;3-7H2,1-2H3/i11T2;.
What are the key properties of heptane;methyl-nonyl-ditritiosilane?
heptane;methyl-nonyl-ditritiosilane has a molecular weight of 276.61 g/mol, XLogP of 6.35, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;methyl-nonyl-ditritiosilane is sourced from PubChem (CID 158446190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).