About 2-amino-1,2-dimethylpurin-6-one
2-amino-1,2-dimethylpurin-6-one (PubChem CID 158446721) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-amino-1,2-dimethylpurin-6-one.
Molecular Properties
| Compound Name | 2-amino-1,2-dimethylpurin-6-one |
| PubChem CID | 158446721 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-amino-1,2-dimethylpurin-6-one |
| SMILES | CN1C(=O)C2=NC=NC2=NC1(C)N |
| InChI | InChI=1S/C7H9N5O/c1-7(8)11-5-4(9-3-10-5)6(13)12(7)2/h3H,8H2,1-2H3 |
| InChIKey | HDMCSSJXRCIFAH-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 83.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-1,2-dimethylpurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,2-dimethylpurin-6-one?
The IUPAC name of 2-amino-1,2-dimethylpurin-6-one (CID 158446721) is 2-amino-1,2-dimethylpurin-6-one.
What is the SMILES notation for 2-amino-1,2-dimethylpurin-6-one?
The canonical SMILES for 2-amino-1,2-dimethylpurin-6-one is CN1C(=O)C2=NC=NC2=NC1(C)N.
What is the InChIKey of 2-amino-1,2-dimethylpurin-6-one?
The InChIKey is HDMCSSJXRCIFAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O/c1-7(8)11-5-4(9-3-10-5)6(13)12(7)2/h3H,8H2,1-2H3.
What are the key properties of 2-amino-1,2-dimethylpurin-6-one?
2-amino-1,2-dimethylpurin-6-one has a molecular weight of 179.18 g/mol, XLogP of -1.03, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,2-dimethylpurin-6-one is sourced from PubChem (CID 158446721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).