C23H24N4O — CID 158446862
1,4-dimethyl-N-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propyl]pyrrole-2-carboxamide (PubChem CID 158446862) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is 1,4-dimethyl-N-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propyl]pyrrole-2-carboxamide.
| Compound Name | 1,4-dimethyl-N-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 158446862 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1,4-dimethyl-N-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propyl]pyrrole-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCc2ccc(-c3cnc4[nH]ccc4c3)cc2)n(C)c1 |
| InChI | InChI=1S/C23H24N4O/c1-16-12-21(27(2)15-16)23(28)25-10-3-4-17-5-7-18(8-6-17)20-13-19-9-11-24-22(19)26-14-20/h5-9,11-15H,3-4,10H2,1-2H3,(H,24,26)(H,25,28) |
| InChIKey | SCIZBDYDQMSQKD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|