C11H14BNO2 — CID 158447214
[(3S)-1-hydroxy-3,5,6,7-tetrahydrocyclopenta[f][2,1]benzoxaborol-3-yl]methanamine (PubChem CID 158447214) has the molecular formula C11H14BNO2 and a molecular weight of 203.05 g/mol. Its IUPAC name is [(3S)-1-hydroxy-3,5,6,7-tetrahydrocyclopenta[f][2,1]benzoxaborol-3-yl]methanamine.
| Compound Name | [(3S)-1-hydroxy-3,5,6,7-tetrahydrocyclopenta[f][2,1]benzoxaborol-3-yl]methanamine |
|---|---|
| PubChem CID | 158447214 |
| Molecular Formula | C11H14BNO2 |
| Molecular Weight | 203.05 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | [(3S)-1-hydroxy-3,5,6,7-tetrahydrocyclopenta[f][2,1]benzoxaborol-3-yl]methanamine |
| SMILES | NC[C@H]1OB(O)c2cc3c(cc21)CCC3 |
| InChI | InChI=1S/C11H14BNO2/c13-6-11-9-4-7-2-1-3-8(7)5-10(9)12(14)15-11/h4-5,11,14H,1-3,6,13H2/t11-/m1/s1 |
| InChIKey | JYANASJRVFTRAZ-LLVKDONJSA-N |
| XLogP | -0.11 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.05 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|