About bicyclo[2.2.1]hepta-1,3-diene
bicyclo[2.2.1]hepta-1,3-diene (PubChem CID 158447472) has the molecular formula C14H16
and a molecular weight of 184.28 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-1,3-diene.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hepta-1,3-diene |
| PubChem CID | 158447472 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | bicyclo[2.2.1]hepta-1,3-diene |
| SMILES | C1=C2CCC(=C1)C2.C1=C2CCC(=C1)C2 |
| InChI | InChI=1S/2C7H8/c2*1-2-7-4-3-6(1)5-7/h2*1-2H,3-5H2 |
| InChIKey | HDOIZVSJCLVDSY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bicyclo[2.2.1]hepta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hepta-1,3-diene?
The IUPAC name of bicyclo[2.2.1]hepta-1,3-diene (CID 158447472) is bicyclo[2.2.1]hepta-1,3-diene.
What is the SMILES notation for bicyclo[2.2.1]hepta-1,3-diene?
The canonical SMILES for bicyclo[2.2.1]hepta-1,3-diene is C1=C2CCC(=C1)C2.C1=C2CCC(=C1)C2.
What is the InChIKey of bicyclo[2.2.1]hepta-1,3-diene?
The InChIKey is HDOIZVSJCLVDSY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8/c2*1-2-7-4-3-6(1)5-7/h2*1-2H,3-5H2.
What are the key properties of bicyclo[2.2.1]hepta-1,3-diene?
bicyclo[2.2.1]hepta-1,3-diene has a molecular weight of 184.28 g/mol, XLogP of 4.07, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hepta-1,3-diene is sourced from PubChem (CID 158447472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).