About 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone
2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone (PubChem CID 158448054) has the molecular formula C20H23BO3
and a molecular weight of 322.21 g/mol. Its IUPAC name is 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone.
Molecular Properties
| Compound Name | 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone |
| PubChem CID | 158448054 |
| Molecular Formula | C20H23BO3 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone |
| SMILES | CC(C)Cc1ccc(C(=O)Cc2ccc3c(c2)B(O)OCC3)cc1 |
| InChI | InChI=1S/C20H23BO3/c1-14(2)11-15-3-7-18(8-4-15)20(22)13-16-5-6-17-9-10-24-21(23)19(17)12-16/h3-8,12,14,23H,9-11,13H2,1-2H3 |
| InChIKey | HDQAXAONMYWDJU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone?
The IUPAC name of 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone (CID 158448054) is 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone.
What is the SMILES notation for 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone?
The canonical SMILES for 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone is CC(C)Cc1ccc(C(=O)Cc2ccc3c(c2)B(O)OCC3)cc1.
What is the InChIKey of 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone?
The InChIKey is HDQAXAONMYWDJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23BO3/c1-14(2)11-15-3-7-18(8-4-15)20(22)13-16-5-6-17-9-10-24-21(23)19(17)12-16/h3-8,12,14,23H,9-11,13H2,1-2H3.
What are the key properties of 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone?
2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone has a molecular weight of 322.21 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-[4-(2-methylpropyl)phenyl]ethanone is sourced from PubChem (CID 158448054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).