About 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol
3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol (PubChem CID 158449287) has the molecular formula C15H19F3O
and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol.
Molecular Properties
| Compound Name | 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol |
| PubChem CID | 158449287 |
| Molecular Formula | C15H19F3O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol |
| SMILES | Cc1ccc(C(O)(CC2CCCC2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3O/c1-11-6-8-13(9-7-11)14(19,15(16,17)18)10-12-4-2-3-5-12/h6-9,12,19H,2-5,10H2,1H3 |
| InChIKey | CZGHXFJVNDGNDC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol?
The IUPAC name of 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol (CID 158449287) is 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol.
What is the SMILES notation for 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol?
The canonical SMILES for 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol is Cc1ccc(C(O)(CC2CCCC2)C(F)(F)F)cc1.
What is the InChIKey of 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol?
The InChIKey is CZGHXFJVNDGNDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F3O/c1-11-6-8-13(9-7-11)14(19,15(16,17)18)10-12-4-2-3-5-12/h6-9,12,19H,2-5,10H2,1H3.
What are the key properties of 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol?
3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol has a molecular weight of 272.31 g/mol, XLogP of 4.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol is sourced from PubChem (CID 158449287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).