C21H26F4N4O3Si — CID 158449354
3-amino-1-[[6-fluoro-4-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one (PubChem CID 158449354) has the molecular formula C21H26F4N4O3Si and a molecular weight of 486.54 g/mol. Its IUPAC name is 3-amino-1-[[6-fluoro-4-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one.
| Compound Name | 3-amino-1-[[6-fluoro-4-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 158449354 |
| Molecular Formula | C21H26F4N4O3Si |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 3-amino-1-[[6-fluoro-4-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one |
| SMILES | C[Si](C)(C)CCOCn1c(Cn2cccc(N)c2=O)nc2c(OCC(F)(F)F)cc(F)cc21 |
| InChI | InChI=1S/C21H26F4N4O3Si/c1-33(2,3)8-7-31-13-29-16-9-14(22)10-17(32-12-21(23,24)25)19(16)27-18(29)11-28-6-4-5-15(26)20(28)30/h4-6,9-10H,7-8,11-13,26H2,1-3H3 |
| InChIKey | HDUDRXBFFXMMOH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|