About N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane
N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane (PubChem CID 158449614) has the molecular formula C18H29N3O
and a molecular weight of 303.45 g/mol. Its IUPAC name is N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane.
Molecular Properties
| Compound Name | N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane |
| PubChem CID | 158449614 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane |
| SMILES | C.C.CN(C)c1ccc(N=O)cc1.CN(C)c1ccccc1 |
| InChI | InChI=1S/C8H10N2O.C8H11N.2CH4/c1-10(2)8-5-3-7(9-11)4-6-8;1-9(2)8-6-4-3-5-7-8;;/h3-6H,1-2H3;3-7H,1-2H3;2*1H4 |
| InChIKey | HDUXTUZBBDFNEA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane?
The IUPAC name of N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane (CID 158449614) is N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane.
What is the SMILES notation for N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane?
The canonical SMILES for N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane is C.C.CN(C)c1ccc(N=O)cc1.CN(C)c1ccccc1.
What is the InChIKey of N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane?
The InChIKey is HDUXTUZBBDFNEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O.C8H11N.2CH4/c1-10(2)8-5-3-7(9-11)4-6-8;1-9(2)8-6-4-3-5-7-8;;/h3-6H,1-2H3;3-7H,1-2H3;2*1H4.
What are the key properties of N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane?
N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane has a molecular weight of 303.45 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylaniline;N,N-dimethyl-4-nitrosoaniline;methane is sourced from PubChem (CID 158449614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).