C66H74F2N2OS2 — CID 158450989
6,7-difluoro-2-(3-hexoxyphenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-3-(3-methylphenyl)-8-(5-methylthiophen-2-yl)quinoxaline (PubChem CID 158450989) has the molecular formula C66H74F2N2OS2 and a molecular weight of 1013.46 g/mol. Its IUPAC name is 6,7-difluoro-2-(3-hexoxyphenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-3-(3-methylphenyl)-8-(5-methylthiophen-2-yl)quinoxaline.
| Compound Name | 6,7-difluoro-2-(3-hexoxyphenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-3-(3-methylphenyl)-8-(5-methylthiophen-2-yl)quinoxaline |
|---|---|
| PubChem CID | 158450989 |
| Molecular Formula | C66H74F2N2OS2 |
| Molecular Weight | 1013.46 g/mol |
| Exact Mass | 1012.52 |
| IUPAC Name | 6,7-difluoro-2-(3-hexoxyphenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-3-(3-methylphenyl)-8-(5-methylthiophen-2-yl)quinoxaline |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4c(F)c(F)c(-c5ccc(C)s5)c5nc(-c6cccc(OCCCCCC)c6)c(-c6cccc(C)c6)nc45)s3)cc21 |
| InChI | InChI=1S/C66H74F2N2OS2/c1-7-10-13-16-18-20-37-66(38-21-19-17-14-11-8-2)53-41-45(5)29-32-51(53)52-33-31-47(43-54(52)66)55-35-36-57(73-55)59-61(68)60(67)58(56-34-30-46(6)72-56)64-65(59)69-62(48-26-23-25-44(4)40-48)63(70-64)49-27-24-28-50(42-49)71-39-22-15-12-9-3/h23-36,40-43H,7-22,37-39H2,1-6H3 |
| InChIKey | LQBITOWNQCBYHO-UHFFFAOYSA-N |
| XLogP | 21.02 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.46 |
| LogP ≤ 5 | 21.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|