About 1,7-dimethyl-3H-purine-2,6-dione
1,7-dimethyl-3H-purine-2,6-dione (PubChem CID 158451320) has the molecular formula C14H16N8O4
and a molecular weight of 360.33 g/mol. Its IUPAC name is 1,7-dimethyl-3H-purine-2,6-dione.
Molecular Properties
| Compound Name | 1,7-dimethyl-3H-purine-2,6-dione |
| PubChem CID | 158451320 |
| Molecular Formula | C14H16N8O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1,7-dimethyl-3H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c2ncn(C)c2c1=O.Cn1c(=O)[nH]c2ncn(C)c2c1=O |
| InChI | InChI=1S/2C7H8N4O2/c2*1-10-3-8-5-4(10)6(12)11(2)7(13)9-5/h2*3H,1-2H3,(H,9,13) |
| InChIKey | HEAFXMWCYOPIDP-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 1,7-dimethyl-3H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dimethyl-3H-purine-2,6-dione?
The IUPAC name of 1,7-dimethyl-3H-purine-2,6-dione (CID 158451320) is 1,7-dimethyl-3H-purine-2,6-dione.
What is the SMILES notation for 1,7-dimethyl-3H-purine-2,6-dione?
The canonical SMILES for 1,7-dimethyl-3H-purine-2,6-dione is Cn1c(=O)[nH]c2ncn(C)c2c1=O.Cn1c(=O)[nH]c2ncn(C)c2c1=O.
What is the InChIKey of 1,7-dimethyl-3H-purine-2,6-dione?
The InChIKey is HEAFXMWCYOPIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8N4O2/c2*1-10-3-8-5-4(10)6(12)11(2)7(13)9-5/h2*3H,1-2H3,(H,9,13).
What are the key properties of 1,7-dimethyl-3H-purine-2,6-dione?
1,7-dimethyl-3H-purine-2,6-dione has a molecular weight of 360.33 g/mol, XLogP of -2.08, 0 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethyl-3H-purine-2,6-dione is sourced from PubChem (CID 158451320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).