C18H17N5O2 — CID 158452831
N'-[4-[(3aS)-3a-hydroxy-6-methyl-4-oxo-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl]-2-pyridinyl]methanimidamide (PubChem CID 158452831) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is N'-[4-[(3aS)-3a-hydroxy-6-methyl-4-oxo-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl]-2-pyridinyl]methanimidamide.
| Compound Name | N'-[4-[(3aS)-3a-hydroxy-6-methyl-4-oxo-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl]-2-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 158452831 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N'-[4-[(3aS)-3a-hydroxy-6-methyl-4-oxo-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl]-2-pyridinyl]methanimidamide |
| SMILES | Cc1ccc2c(c1)C(=O)[C@]1(O)CCN(c3ccnc(/N=C/N)c3)C1=N2 |
| InChI | InChI=1S/C18H17N5O2/c1-11-2-3-14-13(8-11)16(24)18(25)5-7-23(17(18)22-14)12-4-6-20-15(9-12)21-10-19/h2-4,6,8-10,25H,5,7H2,1H3,(H2,19,20,21)/t18-/m1/s1 |
| InChIKey | HEFAHUZHTCBEJU-GOSISDBHSA-N |
| XLogP | 1.88 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|