C17H17F13O3 — CID 158453930
7-oxabicyclo[2.2.1]heptan-2-yl 2-methylprop-2-enoate;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoroheptane (PubChem CID 158453930) has the molecular formula C17H17F13O3 and a molecular weight of 516.29 g/mol. Its IUPAC name is 7-oxabicyclo[2.2.1]heptan-2-yl 2-methylprop-2-enoate;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoroheptane.
| Compound Name | 7-oxabicyclo[2.2.1]heptan-2-yl 2-methylprop-2-enoate;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoroheptane |
|---|---|
| PubChem CID | 158453930 |
| Molecular Formula | C17H17F13O3 |
| Molecular Weight | 516.29 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 7-oxabicyclo[2.2.1]heptan-2-yl 2-methylprop-2-enoate;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoroheptane |
| SMILES | C=C(C)C(=O)OC1CC2CCC1O2.CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14O3.C7H3F13/c1-6(2)10(11)13-9-5-7-3-4-8(9)12-7;1-2(8,9)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h7-9H,1,3-5H2,2H3;1H3 |
| InChIKey | HEIKZKRPXGZDSJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.29 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|