About 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol
4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol (PubChem CID 158454264) has the molecular formula C17H15NO3S
and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol.
Molecular Properties
| Compound Name | 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol |
| PubChem CID | 158454264 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol |
| SMILES | COc1ccc(-c2nc(-c3ccc(O)cc3)cs2)c(OC)c1 |
| InChI | InChI=1S/C17H15NO3S/c1-20-13-7-8-14(16(9-13)21-2)17-18-15(10-22-17)11-3-5-12(19)6-4-11/h3-10,19H,1-2H3 |
| InChIKey | HEJLHRSYTRXIQY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol?
The IUPAC name of 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol (CID 158454264) is 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol.
What is the SMILES notation for 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol?
The canonical SMILES for 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol is COc1ccc(-c2nc(-c3ccc(O)cc3)cs2)c(OC)c1.
What is the InChIKey of 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol?
The InChIKey is HEJLHRSYTRXIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO3S/c1-20-13-7-8-14(16(9-13)21-2)17-18-15(10-22-17)11-3-5-12(19)6-4-11/h3-10,19H,1-2H3.
What are the key properties of 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol?
4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol has a molecular weight of 313.38 g/mol, XLogP of 4.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol is sourced from PubChem (CID 158454264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).