C20H20N4O4 — CID 158454277
formic acid;N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-1H-pyrazole-5-carboxamide (PubChem CID 158454277) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is formic acid;N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | formic acid;N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 158454277 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | formic acid;N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc([C@@]2(NC(=O)c3ccn[nH]3)CCOc3cccnc32)cc1.O=CO |
| InChI | InChI=1S/C19H18N4O2.CH2O2/c1-13-4-6-14(7-5-13)19(22-18(24)15-8-11-21-23-15)9-12-25-16-3-2-10-20-17(16)19;2-1-3/h2-8,10-11H,9,12H2,1H3,(H,21,23)(H,22,24);1H,(H,2,3)/t19-;/m0./s1 |
| InChIKey | HEJLWYJZXMVXIC-FYZYNONXSA-N |
| XLogP | 2.27 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|