About 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone
1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone (PubChem CID 158454355) has the molecular formula C19H35N3O4
and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone.
Molecular Properties
| Compound Name | 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone |
| PubChem CID | 158454355 |
| Molecular Formula | C19H35N3O4 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone |
| SMILES | CC(=O)N1CCCC1.CC(=O)N1CCCCC1.CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C7H13NO.C6H11NO2.C6H11NO/c1-7(9)8-5-3-2-4-6-8;1-6(8)7-2-4-9-5-3-7;1-6(8)7-4-2-3-5-7/h2-6H2,1H3;2-5H2,1H3;2-5H2,1H3 |
| InChIKey | HEJQPRXPOJALIJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone?
The IUPAC name of 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone (CID 158454355) is 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone.
What is the SMILES notation for 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone?
The canonical SMILES for 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone is CC(=O)N1CCCC1.CC(=O)N1CCCCC1.CC(=O)N1CCOCC1.
What is the InChIKey of 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone?
The InChIKey is HEJQPRXPOJALIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C6H11NO2.C6H11NO/c1-7(9)8-5-3-2-4-6-8;1-6(8)7-2-4-9-5-3-7;1-6(8)7-4-2-3-5-7/h2-6H2,1H3;2-5H2,1H3;2-5H2,1H3.
What are the key properties of 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone?
1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone has a molecular weight of 369.51 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylethanone;1-piperidin-1-ylethanone;1-pyrrolidin-1-ylethanone is sourced from PubChem (CID 158454355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).