About silicic acid;tetramethylazanium
silicic acid;tetramethylazanium (PubChem CID 158454802) has the molecular formula C4H16NO4Si+
and a molecular weight of 170.26 g/mol. Its IUPAC name is silicic acid;tetramethylazanium.
Molecular Properties
| Compound Name | silicic acid;tetramethylazanium |
| PubChem CID | 158454802 |
| Molecular Formula | C4H16NO4Si+ |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | silicic acid;tetramethylazanium |
| SMILES | C[N+](C)(C)C.O[Si](O)(O)O |
| InChI | InChI=1S/C4H12N.H4O4Si/c2*1-5(2,3)4/h1-4H3;1-4H/q+1; |
| InChIKey | HELABVNXROLNTJ-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze silicic acid;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silicic acid;tetramethylazanium?
The IUPAC name of silicic acid;tetramethylazanium (CID 158454802) is silicic acid;tetramethylazanium.
What is the SMILES notation for silicic acid;tetramethylazanium?
The canonical SMILES for silicic acid;tetramethylazanium is C[N+](C)(C)C.O[Si](O)(O)O.
What is the InChIKey of silicic acid;tetramethylazanium?
The InChIKey is HELABVNXROLNTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N.H4O4Si/c2*1-5(2,3)4/h1-4H3;1-4H/q+1;.
What are the key properties of silicic acid;tetramethylazanium?
silicic acid;tetramethylazanium has a molecular weight of 170.26 g/mol, XLogP of -2.29, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silicic acid;tetramethylazanium is sourced from PubChem (CID 158454802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).