C20H40N4O2 — CID 158455362
2,2-dimethyl-1-(4-methylpiperazin-1-yl)propan-1-one (PubChem CID 158455362) has the molecular formula C20H40N4O2 and a molecular weight of 368.57 g/mol. Its IUPAC name is 2,2-dimethyl-1-(4-methylpiperazin-1-yl)propan-1-one.
| Compound Name | 2,2-dimethyl-1-(4-methylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 158455362 |
| Molecular Formula | C20H40N4O2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.32 |
| IUPAC Name | 2,2-dimethyl-1-(4-methylpiperazin-1-yl)propan-1-one |
| SMILES | CN1CCN(C(=O)C(C)(C)C)CC1.CN1CCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/2C10H20N2O/c2*1-10(2,3)9(13)12-7-5-11(4)6-8-12/h2*5-8H2,1-4H3 |
| InChIKey | HEMQHNSGORXXFP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |