C40H57N5O4 — CID 158455655
2-tert-butyl-1-(cyclohexylmethyl)benzimidazole-5-carboxylic acid;2-tert-butyl-1-(cyclohexylmethyl)-N-ethoxybenzimidazole-5-carboxamide (PubChem CID 158455655) has the molecular formula C40H57N5O4 and a molecular weight of 671.93 g/mol. Its IUPAC name is 2-tert-butyl-1-(cyclohexylmethyl)benzimidazole-5-carboxylic acid;2-tert-butyl-1-(cyclohexylmethyl)-N-ethoxybenzimidazole-5-carboxamide.
| Compound Name | 2-tert-butyl-1-(cyclohexylmethyl)benzimidazole-5-carboxylic acid;2-tert-butyl-1-(cyclohexylmethyl)-N-ethoxybenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 158455655 |
| Molecular Formula | C40H57N5O4 |
| Molecular Weight | 671.93 g/mol |
| Exact Mass | 671.44 |
| IUPAC Name | 2-tert-butyl-1-(cyclohexylmethyl)benzimidazole-5-carboxylic acid;2-tert-butyl-1-(cyclohexylmethyl)-N-ethoxybenzimidazole-5-carboxamide |
| SMILES | CC(C)(C)c1nc2cc(C(=O)O)ccc2n1CC1CCCCC1.CCONC(=O)c1ccc2c(c1)nc(C(C)(C)C)n2CC1CCCCC1 |
| InChI | InChI=1S/C21H31N3O2.C19H26N2O2/c1-5-26-23-19(25)16-11-12-18-17(13-16)22-20(21(2,3)4)24(18)14-15-9-7-6-8-10-15;1-19(2,3)18-20-15-11-14(17(22)23)9-10-16(15)21(18)12-13-7-5-4-6-8-13/h11-13,15H,5-10,14H2,1-4H3,(H,23,25);9-11,13H,4-8,12H2,1-3H3,(H,22,23) |
| InChIKey | HENOQKWSMWKJCS-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.93 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|