About trifluoromethanesulfonate;2,4,6-trimethylpyrylium
trifluoromethanesulfonate;2,4,6-trimethylpyrylium (PubChem CID 15845575) has the molecular formula C9H11F3O4S
and a molecular weight of 272.24 g/mol. Its IUPAC name is trifluoromethanesulfonate;2,4,6-trimethylpyrylium.
Molecular Properties
| Compound Name | trifluoromethanesulfonate;2,4,6-trimethylpyrylium |
| PubChem CID | 15845575 |
| Molecular Formula | C9H11F3O4S |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | trifluoromethanesulfonate;2,4,6-trimethylpyrylium |
| SMILES | Cc1cc(C)[o+]c(C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C8H11O.CHF3O3S/c1-6-4-7(2)9-8(3)5-6;2-1(3,4)8(5,6)7/h4-5H,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | FCPRZFWDVUXXNH-UHFFFAOYSA-M |
| XLogP | 2.54 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethanesulfonate;2,4,6-trimethylpyrylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethanesulfonate;2,4,6-trimethylpyrylium?
The IUPAC name of trifluoromethanesulfonate;2,4,6-trimethylpyrylium (CID 15845575) is trifluoromethanesulfonate;2,4,6-trimethylpyrylium.
What is the SMILES notation for trifluoromethanesulfonate;2,4,6-trimethylpyrylium?
The canonical SMILES for trifluoromethanesulfonate;2,4,6-trimethylpyrylium is Cc1cc(C)[o+]c(C)c1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of trifluoromethanesulfonate;2,4,6-trimethylpyrylium?
The InChIKey is FCPRZFWDVUXXNH-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H11O.CHF3O3S/c1-6-4-7(2)9-8(3)5-6;2-1(3,4)8(5,6)7/h4-5H,1-3H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of trifluoromethanesulfonate;2,4,6-trimethylpyrylium?
trifluoromethanesulfonate;2,4,6-trimethylpyrylium has a molecular weight of 272.24 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethanesulfonate;2,4,6-trimethylpyrylium is sourced from PubChem (CID 15845575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).