C23H26F6N2O3 — CID 158455994
(4aR,8aS)-6-[3-[4,4,4-trifluoro-3-[3-(trifluoromethyl)phenyl]butyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 158455994) has the molecular formula C23H26F6N2O3 and a molecular weight of 492.46 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-[4,4,4-trifluoro-3-[3-(trifluoromethyl)phenyl]butyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[3-[4,4,4-trifluoro-3-[3-(trifluoromethyl)phenyl]butyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 158455994 |
| Molecular Formula | C23H26F6N2O3 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (4aR,8aS)-6-[3-[4,4,4-trifluoro-3-[3-(trifluoromethyl)phenyl]butyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CC(CCC(c4cccc(C(F)(F)F)c4)C(F)(F)F)C3)C[C@H]2C1 |
| InChI | InChI=1S/C23H26F6N2O3/c24-22(25,26)17-3-1-2-15(8-17)19(23(27,28)29)5-4-14-10-31(11-14)21(33)30-7-6-20-16(12-30)9-18(32)13-34-20/h1-3,8,14,16,19-20H,4-7,9-13H2/t16-,19?,20+/m1/s1 |
| InChIKey | HEOPBTRFIUBZFQ-VBHUFULTSA-N |
| XLogP | 4.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |