C18H22N2O4 — CID 158456566
ethyl 4-methylpyridine-2-carboxylate;ethyl 5-methylpyridine-2-carboxylate (PubChem CID 158456566) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is ethyl 4-methylpyridine-2-carboxylate;ethyl 5-methylpyridine-2-carboxylate.
| Compound Name | ethyl 4-methylpyridine-2-carboxylate;ethyl 5-methylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 158456566 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethyl 4-methylpyridine-2-carboxylate;ethyl 5-methylpyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(C)ccn1.CCOC(=O)c1ccc(C)cn1 |
| InChI | InChI=1S/2C9H11NO2/c1-3-12-9(11)8-6-7(2)4-5-10-8;1-3-12-9(11)8-5-4-7(2)6-10-8/h2*4-6H,3H2,1-2H3 |
| InChIKey | HEQHYXYLEOEGDE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |