C33H48N2O2 — CID 158457147
N-(cyclopropylmethyl)-5-methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;N-(cyclopropylmethyl)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 158457147) has the molecular formula C33H48N2O2 and a molecular weight of 504.76 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-5-methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;N-(cyclopropylmethyl)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N-(cyclopropylmethyl)-5-methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;N-(cyclopropylmethyl)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 158457147 |
| Molecular Formula | C33H48N2O2 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.37 |
| IUPAC Name | N-(cyclopropylmethyl)-5-methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;N-(cyclopropylmethyl)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCN(CC1CC1)C1CCc2c(cccc2OC)C1.COc1cccc2c1CCC(NCC1CC1)C2 |
| InChI | InChI=1S/C18H27NO.C15H21NO/c1-3-11-19(13-14-7-8-14)16-9-10-17-15(12-16)5-4-6-18(17)20-2;1-17-15-4-2-3-12-9-13(7-8-14(12)15)16-10-11-5-6-11/h4-6,14,16H,3,7-13H2,1-2H3;2-4,11,13,16H,5-10H2,1H3 |
| InChIKey | HESDPEVAWRSWIF-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |