C21H45N3O — CID 158457421
2,3-diamino-N-octadecylpropanamide (PubChem CID 158457421) has the molecular formula C21H45N3O and a molecular weight of 355.61 g/mol. Its IUPAC name is 2,3-diamino-N-octadecylpropanamide.
| Compound Name | 2,3-diamino-N-octadecylpropanamide |
|---|---|
| PubChem CID | 158457421 |
| Molecular Formula | C21H45N3O |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.36 |
| IUPAC Name | 2,3-diamino-N-octadecylpropanamide |
| SMILES | CCCCCCCCCCCCCCCCCCNC(=O)C(N)CN |
| InChI | InChI=1S/C21H45N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-21(25)20(23)19-22/h20H,2-19,22-23H2,1H3,(H,24,25) |
| InChIKey | HETAVXZEYQYREI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|