C24H41IO5Si — CID 158457691
[(2S,3S,4E,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 158457691) has the molecular formula C24H41IO5Si and a molecular weight of 564.58 g/mol. Its IUPAC name is [(2S,3S,4E,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,3S,4E,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 158457691 |
| Molecular Formula | C24H41IO5Si |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | [(2S,3S,4E,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C/[C@H](C)[C@@H](/C(C)=C/I)OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C24H41IO5Si/c1-16-10-12-20(30-31(8,9)24(5,6)7)14-22(27)29-23(18(3)15-25)17(2)11-13-21(16)28-19(4)26/h11,13,15-17,20-21,23H,10,12,14H2,1-9H3/b13-11+,18-15+/t16-,17-,20+,21-,23-/m0/s1 |
| InChIKey | UULGSHLFUNXHCZ-PRZNWKGNSA-N |
| XLogP | 6.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|