About di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium
di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium (PubChem CID 158459253) has the molecular formula C17H42N2+2
and a molecular weight of 274.54 g/mol. Its IUPAC name is di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium.
Molecular Properties
| Compound Name | di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium |
| PubChem CID | 158459253 |
| Molecular Formula | C17H42N2+2 |
| Molecular Weight | 274.54 g/mol |
| Exact Mass | 274.33 |
| IUPAC Name | di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium |
| SMILES | C.C.CC(C)=[N+](C(C)C)C(C)C.CC(C)=[NH+]C(C)C |
| InChI | InChI=1S/C9H20N.C6H13N.2CH4/c1-7(2)10(8(3)4)9(5)6;1-5(2)7-6(3)4;;/h7-8H,1-6H3;5H,1-4H3;2*1H4/q+1;;;/p+1 |
| InChIKey | AGSXQYJRMYERKJ-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 16.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium?
The IUPAC name of di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium (CID 158459253) is di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium.
What is the SMILES notation for di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium?
The canonical SMILES for di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium is C.C.CC(C)=[N+](C(C)C)C(C)C.CC(C)=[NH+]C(C)C.
What is the InChIKey of di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium?
The InChIKey is AGSXQYJRMYERKJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H20N.C6H13N.2CH4/c1-7(2)10(8(3)4)9(5)6;1-5(2)7-6(3)4;;/h7-8H,1-6H3;5H,1-4H3;2*1H4/q+1;;;/p+1.
What are the key properties of di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium?
di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium has a molecular weight of 274.54 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for di(propan-2-yl)-propan-2-ylideneazanium;methane;propan-2-yl(propan-2-ylidene)azanium is sourced from PubChem (CID 158459253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).