About 2-benzylpropanedinitrile
2-benzylpropanedinitrile (PubChem CID 15846) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 2-benzylpropanedinitrile.
Molecular Properties
| Compound Name | 2-benzylpropanedinitrile |
| PubChem CID | 15846 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2-benzylpropanedinitrile |
| SMILES | N#CC(C#N)Cc1ccccc1 |
| InChI | InChI=1S/C10H8N2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-5,10H,6H2 |
| InChIKey | ODFHXXQVNHHDDG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylpropanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylpropanedinitrile?
The IUPAC name of 2-benzylpropanedinitrile (CID 15846) is 2-benzylpropanedinitrile.
What is the SMILES notation for 2-benzylpropanedinitrile?
The canonical SMILES for 2-benzylpropanedinitrile is N#CC(C#N)Cc1ccccc1.
What is the InChIKey of 2-benzylpropanedinitrile?
The InChIKey is ODFHXXQVNHHDDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-5,10H,6H2.
What are the key properties of 2-benzylpropanedinitrile?
2-benzylpropanedinitrile has a molecular weight of 156.19 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylpropanedinitrile is sourced from PubChem (CID 15846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).