C22H16Cl4I3O3V — CID 158460761
2,2-dichloro-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one;1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one;triiodovanadium (PubChem CID 158460761) has the molecular formula C22H16Cl4I3O3V and a molecular weight of 901.83 g/mol. Its IUPAC name is 2,2-dichloro-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one;1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one;triiodovanadium.
| Compound Name | 2,2-dichloro-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one;1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one;triiodovanadium |
|---|---|
| PubChem CID | 158460761 |
| Molecular Formula | C22H16Cl4I3O3V |
| Molecular Weight | 901.83 g/mol |
| Exact Mass | 899.64 |
| IUPAC Name | 2,2-dichloro-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one;1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one;triiodovanadium |
| SMILES | I[V](I)I.O=C1C2Cc3ccccc3C2C1(Cl)Cl.O=C1OC2Cc3ccccc3C2C1(Cl)Cl |
| InChI | InChI=1S/C11H8Cl2O2.C11H8Cl2O.3HI.V/c12-11(13)9-7-4-2-1-3-6(7)5-8(9)15-10(11)14;12-11(13)9-7-4-2-1-3-6(7)5-8(9)10(11)14;;;;/h1-4,8-9H,5H2;1-4,8-9H,5H2;3*1H;/q;;;;;+3/p-3 |
| InChIKey | HFDIKFRJIKLTBV-UHFFFAOYSA-K |
| XLogP | 7.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.83 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|