C17H20F2N4O4 — CID 158461276
6-(difluoromethoxy)-N-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-1H-indazole-3-carboxamide;formic acid (PubChem CID 158461276) has the molecular formula C17H20F2N4O4 and a molecular weight of 382.37 g/mol. Its IUPAC name is 6-(difluoromethoxy)-N-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-1H-indazole-3-carboxamide;formic acid.
| Compound Name | 6-(difluoromethoxy)-N-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-1H-indazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 158461276 |
| Molecular Formula | C17H20F2N4O4 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 6-(difluoromethoxy)-N-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-1H-indazole-3-carboxamide;formic acid |
| SMILES | CN1CC2CC1CC2NC(=O)c1n[nH]c2cc(OC(F)F)ccc12.O=CO |
| InChI | InChI=1S/C16H18F2N4O2.CH2O2/c1-22-7-8-4-9(22)5-12(8)19-15(23)14-11-3-2-10(24-16(17)18)6-13(11)20-21-14;2-1-3/h2-3,6,8-9,12,16H,4-5,7H2,1H3,(H,19,23)(H,20,21);1H,(H,2,3) |
| InChIKey | HFEWYHOBZNLPDP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|