About 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate
3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate (PubChem CID 158462256) has the molecular formula C30H40O4
and a molecular weight of 464.65 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate |
| PubChem CID | 158462256 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate |
| SMILES | CC(=Cc1ccc(C(C)(C)C)cc1)C(=O)O.CCOC(=O)C(C)=Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22O2.C14H18O2/c1-6-18-15(17)12(2)11-13-7-9-14(10-8-13)16(3,4)5;1-10(13(15)16)9-11-5-7-12(8-6-11)14(2,3)4/h7-11H,6H2,1-5H3;5-9H,1-4H3,(H,15,16) |
| InChIKey | HFIASUDLFHSOEW-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate?
The IUPAC name of 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate (CID 158462256) is 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate.
What is the SMILES notation for 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate?
The canonical SMILES for 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate is CC(=Cc1ccc(C(C)(C)C)cc1)C(=O)O.CCOC(=O)C(C)=Cc1ccc(C(C)(C)C)cc1.
What is the InChIKey of 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate?
The InChIKey is HFIASUDLFHSOEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2.C14H18O2/c1-6-18-15(17)12(2)11-13-7-9-14(10-8-13)16(3,4)5;1-10(13(15)16)9-11-5-7-12(8-6-11)14(2,3)4/h7-11H,6H2,1-5H3;5-9H,1-4H3,(H,15,16).
What are the key properties of 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate?
3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate has a molecular weight of 464.65 g/mol, XLogP of 7.42, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate is sourced from PubChem (CID 158462256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).