C30H40O4 — CID 158462256
3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate (PubChem CID 158462256) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate.
| Compound Name | 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158462256 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 3-(4-tert-butylphenyl)-2-methylprop-2-enoic acid;ethyl 3-(4-tert-butylphenyl)-2-methylprop-2-enoate |
| SMILES | CC(=Cc1ccc(C(C)(C)C)cc1)C(=O)O.CCOC(=O)C(C)=Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22O2.C14H18O2/c1-6-18-15(17)12(2)11-13-7-9-14(10-8-13)16(3,4)5;1-10(13(15)16)9-11-5-7-12(8-6-11)14(2,3)4/h7-11H,6H2,1-5H3;5-9H,1-4H3,(H,15,16) |
| InChIKey | HFIASUDLFHSOEW-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|