About potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide
potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide (PubChem CID 158463195) has the molecular formula C4H6F3KNO4S2-
and a molecular weight of 292.32 g/mol. Its IUPAC name is potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide.
Molecular Properties
| Compound Name | potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide |
| PubChem CID | 158463195 |
| Molecular Formula | C4H6F3KNO4S2- |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 291.93 |
| IUPAC Name | potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide |
| SMILES | C=CCS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[H-].[K+] |
| InChI | InChI=1S/C4H5F3NO4S2.K.H/c1-2-3-13(9,10)8-14(11,12)4(5,6)7;;/h2H,1,3H2;;/q-1;+1;-1 |
| InChIKey | UXPRSYAXWQWCIF-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide?
The IUPAC name of potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide (CID 158463195) is potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide.
What is the SMILES notation for potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide?
The canonical SMILES for potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide is C=CCS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[H-].[K+].
What is the InChIKey of potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide?
The InChIKey is UXPRSYAXWQWCIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F3NO4S2.K.H/c1-2-3-13(9,10)8-14(11,12)4(5,6)7;;/h2H,1,3H2;;/q-1;+1;-1.
What are the key properties of potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide?
potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide has a molecular weight of 292.32 g/mol, XLogP of -2.16, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide is sourced from PubChem (CID 158463195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).