About 3-fluoro-1,5-dimethyl-4-methylidenepyridine
3-fluoro-1,5-dimethyl-4-methylidenepyridine (PubChem CID 158463657) has the molecular formula C8H10FN
and a molecular weight of 139.17 g/mol. Its IUPAC name is 3-fluoro-1,5-dimethyl-4-methylidenepyridine.
Molecular Properties
| Compound Name | 3-fluoro-1,5-dimethyl-4-methylidenepyridine |
| PubChem CID | 158463657 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 3-fluoro-1,5-dimethyl-4-methylidenepyridine |
| SMILES | C=C1C(C)=CN(C)C=C1F |
| InChI | InChI=1S/C8H10FN/c1-6-4-10(3)5-8(9)7(6)2/h4-5H,2H2,1,3H3 |
| InChIKey | SWTUMMMPXQZUTC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-1,5-dimethyl-4-methylidenepyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,5-dimethyl-4-methylidenepyridine?
The IUPAC name of 3-fluoro-1,5-dimethyl-4-methylidenepyridine (CID 158463657) is 3-fluoro-1,5-dimethyl-4-methylidenepyridine.
What is the SMILES notation for 3-fluoro-1,5-dimethyl-4-methylidenepyridine?
The canonical SMILES for 3-fluoro-1,5-dimethyl-4-methylidenepyridine is C=C1C(C)=CN(C)C=C1F.
What is the InChIKey of 3-fluoro-1,5-dimethyl-4-methylidenepyridine?
The InChIKey is SWTUMMMPXQZUTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN/c1-6-4-10(3)5-8(9)7(6)2/h4-5H,2H2,1,3H3.
What are the key properties of 3-fluoro-1,5-dimethyl-4-methylidenepyridine?
3-fluoro-1,5-dimethyl-4-methylidenepyridine has a molecular weight of 139.17 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,5-dimethyl-4-methylidenepyridine is sourced from PubChem (CID 158463657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).