About (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane
(1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane (PubChem CID 158464094) has the molecular formula C30H34O4
and a molecular weight of 458.60 g/mol. Its IUPAC name is (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane.
Molecular Properties
| Compound Name | (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane |
| PubChem CID | 158464094 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane |
| SMILES | C.CCOc1cccc(-c2ccccc2C(=O)OC(C(=O)c2ccccc2)C2CCCCC2)c1 |
| InChI | InChI=1S/C29H30O4.CH4/c1-2-32-24-17-11-16-23(20-24)25-18-9-10-19-26(25)29(31)33-28(22-14-7-4-8-15-22)27(30)21-12-5-3-6-13-21;/h3,5-6,9-13,16-20,22,28H,2,4,7-8,14-15H2,1H3;1H4 |
| InChIKey | HFNPMBAVKGNQFI-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane?
The IUPAC name of (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane (CID 158464094) is (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane.
What is the SMILES notation for (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane?
The canonical SMILES for (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane is C.CCOc1cccc(-c2ccccc2C(=O)OC(C(=O)c2ccccc2)C2CCCCC2)c1.
What is the InChIKey of (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane?
The InChIKey is HFNPMBAVKGNQFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30O4.CH4/c1-2-32-24-17-11-16-23(20-24)25-18-9-10-19-26(25)29(31)33-28(22-14-7-4-8-15-22)27(30)21-12-5-3-6-13-21;/h3,5-6,9-13,16-20,22,28H,2,4,7-8,14-15H2,1H3;1H4.
What are the key properties of (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane?
(1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane has a molecular weight of 458.60 g/mol, XLogP of 7.38, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane is sourced from PubChem (CID 158464094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).