C30H34O4 — CID 158464094
(1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane (PubChem CID 158464094) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane.
| Compound Name | (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane |
|---|---|
| PubChem CID | 158464094 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (1-cyclohexyl-2-oxo-2-phenylethyl) 2-(3-ethoxyphenyl)benzoate;methane |
| SMILES | C.CCOc1cccc(-c2ccccc2C(=O)OC(C(=O)c2ccccc2)C2CCCCC2)c1 |
| InChI | InChI=1S/C29H30O4.CH4/c1-2-32-24-17-11-16-23(20-24)25-18-9-10-19-26(25)29(31)33-28(22-14-7-4-8-15-22)27(30)21-12-5-3-6-13-21;/h3,5-6,9-13,16-20,22,28H,2,4,7-8,14-15H2,1H3;1H4 |
| InChIKey | HFNPMBAVKGNQFI-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |