C13H14BrN3O3 — CID 158464291
2-(4-bromophenyl)-N-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 158464291) has the molecular formula C13H14BrN3O3 and a molecular weight of 340.18 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | 2-(4-bromophenyl)-N-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 158464291 |
| Molecular Formula | C13H14BrN3O3 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 2-(4-bromophenyl)-N-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CC1(C)NC(=O)N(NC(=O)Cc2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C13H14BrN3O3/c1-13(2)11(19)17(12(20)15-13)16-10(18)7-8-3-5-9(14)6-4-8/h3-6H,7H2,1-2H3,(H,15,20)(H,16,18) |
| InChIKey | HFOHBUMDFOGOQT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|