C15H28Li2N2Si — CID 15846480
dilithium;2-(dimethylamino)ethyl-[dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]azanide (PubChem CID 15846480) has the molecular formula C15H28Li2N2Si and a molecular weight of 278.37 g/mol. Its IUPAC name is dilithium;2-(dimethylamino)ethyl-[dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]azanide.
| Compound Name | dilithium;2-(dimethylamino)ethyl-[dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]azanide |
|---|---|
| PubChem CID | 15846480 |
| Molecular Formula | C15H28Li2N2Si |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.23 |
| IUPAC Name | dilithium;2-(dimethylamino)ethyl-[dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]azanide |
| SMILES | Cc1c(C)c(C)[c-]([Si](C)(C)[N-]CCN(C)C)c1C.[Li+].[Li+] |
| InChI | InChI=1S/C15H28N2Si.2Li/c1-11-12(2)14(4)15(13(11)3)18(7,8)16-9-10-17(5)6;;/h9-10H2,1-8H3;;/q-2;2*+1 |
| InChIKey | BKYFEWMPNJHWDW-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|