C36H54N4O7 — CID 158465070
2-[3-[[2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinolin-3-yl]methylamino]propoxy]acetic acid;4-[[2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinolin-3-yl]methyl]-1,4-oxazepan-3-one (PubChem CID 158465070) has the molecular formula C36H54N4O7 and a molecular weight of 654.85 g/mol. Its IUPAC name is 2-[3-[[2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinolin-3-yl]methylamino]propoxy]acetic acid;4-[[2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinolin-3-yl]methyl]-1,4-oxazepan-3-one.
| Compound Name | 2-[3-[[2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinolin-3-yl]methylamino]propoxy]acetic acid;4-[[2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinolin-3-yl]methyl]-1,4-oxazepan-3-one |
|---|---|
| PubChem CID | 158465070 |
| Molecular Formula | C36H54N4O7 |
| Molecular Weight | 654.85 g/mol |
| Exact Mass | 654.40 |
| IUPAC Name | 2-[3-[[2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinolin-3-yl]methylamino]propoxy]acetic acid;4-[[2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinolin-3-yl]methyl]-1,4-oxazepan-3-one |
| SMILES | COC(C)c1nc2c(cc1CN1CCCOCC1=O)CCCC2.COC(C)c1nc2c(cc1CNCCCOCC(=O)O)CCCC2 |
| InChI | InChI=1S/C18H28N2O4.C18H26N2O3/c1-13(23-2)18-15(10-14-6-3-4-7-16(14)20-18)11-19-8-5-9-24-12-17(21)22;1-13(22-2)18-15(10-14-6-3-4-7-16(14)19-18)11-20-8-5-9-23-12-17(20)21/h10,13,19H,3-9,11-12H2,1-2H3,(H,21,22);10,13H,3-9,11-12H2,1-2H3 |
| InChIKey | HFQQFQSYEGRSFC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 132.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.85 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|