About chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid
chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid (PubChem CID 158468686) has the molecular formula C13H20ClNO2
and a molecular weight of 257.76 g/mol. Its IUPAC name is chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid.
Molecular Properties
| Compound Name | chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid |
| PubChem CID | 158468686 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid |
| SMILES | CN[C@H](C(=O)O)C(C)C.ClCc1ccccc1 |
| InChI | InChI=1S/C7H7Cl.C6H13NO2/c8-6-7-4-2-1-3-5-7;1-4(2)5(7-3)6(8)9/h1-5H,6H2;4-5,7H,1-3H3,(H,8,9)/t;5-/m.0/s1 |
| InChIKey | HGBRACWMAMOLQL-ZSCHJXSPSA-N |
| XLogP | 2.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid?
The IUPAC name of chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid (CID 158468686) is chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid.
What is the SMILES notation for chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid?
The canonical SMILES for chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid is CN[C@H](C(=O)O)C(C)C.ClCc1ccccc1.
What is the InChIKey of chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid?
The InChIKey is HGBRACWMAMOLQL-ZSCHJXSPSA-N. The full InChI is InChI=1S/C7H7Cl.C6H13NO2/c8-6-7-4-2-1-3-5-7;1-4(2)5(7-3)6(8)9/h1-5H,6H2;4-5,7H,1-3H3,(H,8,9)/t;5-/m.0/s1.
What are the key properties of chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid?
chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid has a molecular weight of 257.76 g/mol, XLogP of 2.74, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethylbenzene;(2S)-3-methyl-2-(methylamino)butanoic acid is sourced from PubChem (CID 158468686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).