C41H40Cl2F3N7O6 — CID 158469205
benzamide;2,6-dichloro-N-(4-morpholin-2-ylphenyl)pyridine-4-carboxamide;N-(4-morpholin-2-ylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 158469205) has the molecular formula C41H40Cl2F3N7O6 and a molecular weight of 854.71 g/mol. Its IUPAC name is benzamide;2,6-dichloro-N-(4-morpholin-2-ylphenyl)pyridine-4-carboxamide;N-(4-morpholin-2-ylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | benzamide;2,6-dichloro-N-(4-morpholin-2-ylphenyl)pyridine-4-carboxamide;N-(4-morpholin-2-ylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 158469205 |
| Molecular Formula | C41H40Cl2F3N7O6 |
| Molecular Weight | 854.71 g/mol |
| Exact Mass | 853.24 |
| IUPAC Name | benzamide;2,6-dichloro-N-(4-morpholin-2-ylphenyl)pyridine-4-carboxamide;N-(4-morpholin-2-ylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccccc1.O=C(Nc1ccc(C2CNCCO2)cc1)c1cc(Cl)nc(Cl)c1.O=C(Nc1ccc(C2CNCCO2)cc1)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C18H18F3N3O3.C16H15Cl2N3O2.C7H7NO/c19-18(20,21)11-27-16-6-3-13(9-23-16)17(25)24-14-4-1-12(2-5-14)15-10-22-7-8-26-15;17-14-7-11(8-15(18)21-14)16(22)20-12-3-1-10(2-4-12)13-9-19-5-6-23-13;8-7(9)6-4-2-1-3-5-6/h1-6,9,15,22H,7-8,10-11H2,(H,24,25);1-4,7-8,13,19H,5-6,9H2,(H,20,22);1-5H,(H2,8,9) |
| InChIKey | HGDHLPAPKFBTGA-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 178.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.71 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|