About N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide
N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide (PubChem CID 158469877) has the molecular formula C15H11F2N3O4
and a molecular weight of 335.27 g/mol. Its IUPAC name is N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide.
Molecular Properties
| Compound Name | N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide |
| PubChem CID | 158469877 |
| Molecular Formula | C15H11F2N3O4 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide |
| SMILES | CC(=O)N(C(C)=O)c1nc(-c2ccc(F)cc2F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11F2N3O4/c1-8(21)19(9(2)22)15-14(20(23)24)6-5-13(18-15)11-4-3-10(16)7-12(11)17/h3-7H,1-2H3 |
| InChIKey | HMCWQDPFDTZDJI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide?
The IUPAC name of N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide (CID 158469877) is N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide.
What is the SMILES notation for N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide?
The canonical SMILES for N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide is CC(=O)N(C(C)=O)c1nc(-c2ccc(F)cc2F)ccc1[N+](=O)[O-].
What is the InChIKey of N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide?
The InChIKey is HMCWQDPFDTZDJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2N3O4/c1-8(21)19(9(2)22)15-14(20(23)24)6-5-13(18-15)11-4-3-10(16)7-12(11)17/h3-7H,1-2H3.
What are the key properties of N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide?
N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide has a molecular weight of 335.27 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]acetamide is sourced from PubChem (CID 158469877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).