C29H38N6O2 — CID 158470090
tert-butyl 4-(1H-indazol-5-yl)piperidine-1-carboxylate;5-piperidin-4-yl-1H-indazole (PubChem CID 158470090) has the molecular formula C29H38N6O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is tert-butyl 4-(1H-indazol-5-yl)piperidine-1-carboxylate;5-piperidin-4-yl-1H-indazole.
| Compound Name | tert-butyl 4-(1H-indazol-5-yl)piperidine-1-carboxylate;5-piperidin-4-yl-1H-indazole |
|---|---|
| PubChem CID | 158470090 |
| Molecular Formula | C29H38N6O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | tert-butyl 4-(1H-indazol-5-yl)piperidine-1-carboxylate;5-piperidin-4-yl-1H-indazole |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc3[nH]ncc3c2)CC1.c1cc2[nH]ncc2cc1C1CCNCC1 |
| InChI | InChI=1S/C17H23N3O2.C12H15N3/c1-17(2,3)22-16(21)20-8-6-12(7-9-20)13-4-5-15-14(10-13)11-18-19-15;1-2-12-11(8-14-15-12)7-10(1)9-3-5-13-6-4-9/h4-5,10-12H,6-9H2,1-3H3,(H,18,19);1-2,7-9,13H,3-6H2,(H,14,15) |
| InChIKey | HGGATPRETXZLAG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |