C33H26Cl2N2O2 — CID 158471925
(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-[5-ethynyl-2-(4-methoxyphenoxy)phenyl]spiro[indole-3,3'-piperidine] (PubChem CID 158471925) has the molecular formula C33H26Cl2N2O2 and a molecular weight of 553.49 g/mol. Its IUPAC name is (2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-[5-ethynyl-2-(4-methoxyphenoxy)phenyl]spiro[indole-3,3'-piperidine].
| Compound Name | (2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-[5-ethynyl-2-(4-methoxyphenoxy)phenyl]spiro[indole-3,3'-piperidine] |
|---|---|
| PubChem CID | 158471925 |
| Molecular Formula | C33H26Cl2N2O2 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | (2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-[5-ethynyl-2-(4-methoxyphenoxy)phenyl]spiro[indole-3,3'-piperidine] |
| SMILES | C#Cc1ccc(Oc2ccc(OC)cc2)c([C@@H]2NCC[C@@H](c3cccc(Cl)c3)[C@]23C=Nc2cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C33H26Cl2N2O2/c1-3-21-7-14-31(39-26-11-9-25(38-2)10-12-26)27(17-21)32-33(20-37-30-19-24(35)8-13-29(30)33)28(15-16-36-32)22-5-4-6-23(34)18-22/h1,4-14,17-20,28,32,36H,15-16H2,2H3/t28-,32-,33-/m0/s1 |
| InChIKey | HGLKNMAPQHTADC-RMFXYIPJSA-N |
| XLogP | 8.25 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|