About hydroxylamine;isoquinoline
hydroxylamine;isoquinoline (PubChem CID 158472415) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is hydroxylamine;isoquinoline.
Molecular Properties
| Compound Name | hydroxylamine;isoquinoline |
| PubChem CID | 158472415 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | hydroxylamine;isoquinoline |
| SMILES | NO.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C9H7N.H3NO/c1-2-4-9-7-10-6-5-8(9)3-1;1-2/h1-7H;2H,1H2 |
| InChIKey | HGMZNNWOKVCZRI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxylamine;isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxylamine;isoquinoline?
The IUPAC name of hydroxylamine;isoquinoline (CID 158472415) is hydroxylamine;isoquinoline.
What is the SMILES notation for hydroxylamine;isoquinoline?
The canonical SMILES for hydroxylamine;isoquinoline is NO.c1ccc2cnccc2c1.
What is the InChIKey of hydroxylamine;isoquinoline?
The InChIKey is HGMZNNWOKVCZRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.H3NO/c1-2-4-9-7-10-6-5-8(9)3-1;1-2/h1-7H;2H,1H2.
What are the key properties of hydroxylamine;isoquinoline?
hydroxylamine;isoquinoline has a molecular weight of 162.19 g/mol, XLogP of 1.57, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxylamine;isoquinoline is sourced from PubChem (CID 158472415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).