About (4-cyanophenyl)sulfamic acid
(4-cyanophenyl)sulfamic acid (PubChem CID 15847253) has the molecular formula C7H6N2O3S
and a molecular weight of 198.20 g/mol. Its IUPAC name is (4-cyanophenyl)sulfamic acid.
Molecular Properties
| Compound Name | (4-cyanophenyl)sulfamic acid |
| PubChem CID | 15847253 |
| Molecular Formula | C7H6N2O3S |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | (4-cyanophenyl)sulfamic acid |
| SMILES | N#Cc1ccc(NS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H6N2O3S/c8-5-6-1-3-7(4-2-6)9-13(10,11)12/h1-4,9H,(H,10,11,12) |
| InChIKey | DRPAPEPUWLQLOU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl)sulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)sulfamic acid?
The IUPAC name of (4-cyanophenyl)sulfamic acid (CID 15847253) is (4-cyanophenyl)sulfamic acid.
What is the SMILES notation for (4-cyanophenyl)sulfamic acid?
The canonical SMILES for (4-cyanophenyl)sulfamic acid is N#Cc1ccc(NS(=O)(=O)O)cc1.
What is the InChIKey of (4-cyanophenyl)sulfamic acid?
The InChIKey is DRPAPEPUWLQLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O3S/c8-5-6-1-3-7(4-2-6)9-13(10,11)12/h1-4,9H,(H,10,11,12).
What are the key properties of (4-cyanophenyl)sulfamic acid?
(4-cyanophenyl)sulfamic acid has a molecular weight of 198.20 g/mol, XLogP of 0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)sulfamic acid is sourced from PubChem (CID 15847253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).