C28H36N2O5 — CID 158472813
5-(ethylamino)-2-[(4-methoxyphenyl)methyl]-N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-4-oxohexanamide (PubChem CID 158472813) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 5-(ethylamino)-2-[(4-methoxyphenyl)methyl]-N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-4-oxohexanamide.
| Compound Name | 5-(ethylamino)-2-[(4-methoxyphenyl)methyl]-N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-4-oxohexanamide |
|---|---|
| PubChem CID | 158472813 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 5-(ethylamino)-2-[(4-methoxyphenyl)methyl]-N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-4-oxohexanamide |
| SMILES | CCNC(C)C(=O)CC(Cc1ccc(OC)cc1)C(=O)NC(Cc1ccccc1)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C28H36N2O5/c1-5-29-19(2)25(31)17-22(15-21-11-13-23(34-4)14-12-21)27(33)30-24(26(32)28(3)18-35-28)16-20-9-7-6-8-10-20/h6-14,19,22,24,29H,5,15-18H2,1-4H3,(H,30,33) |
| InChIKey | XVTXNFOHISTOPR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|