C39H29Cl2N7O3 — CID 158472861
5-chloro-8-[(dimethylamino)methyl]-1,7-phenanthrolin-6-ol;5-chloro-1,7-phenanthrolin-6-ol;1,7-phenanthrolin-6-ol (PubChem CID 158472861) has the molecular formula C39H29Cl2N7O3 and a molecular weight of 714.61 g/mol. Its IUPAC name is 5-chloro-8-[(dimethylamino)methyl]-1,7-phenanthrolin-6-ol;5-chloro-1,7-phenanthrolin-6-ol;1,7-phenanthrolin-6-ol.
| Compound Name | 5-chloro-8-[(dimethylamino)methyl]-1,7-phenanthrolin-6-ol;5-chloro-1,7-phenanthrolin-6-ol;1,7-phenanthrolin-6-ol |
|---|---|
| PubChem CID | 158472861 |
| Molecular Formula | C39H29Cl2N7O3 |
| Molecular Weight | 714.61 g/mol |
| Exact Mass | 713.17 |
| IUPAC Name | 5-chloro-8-[(dimethylamino)methyl]-1,7-phenanthrolin-6-ol;5-chloro-1,7-phenanthrolin-6-ol;1,7-phenanthrolin-6-ol |
| SMILES | CN(C)Cc1ccc2c(n1)c(O)c(Cl)c1cccnc12.Oc1c(Cl)c2cccnc2c2cccnc12.Oc1cc2cccnc2c2cccnc12 |
| InChI | InChI=1S/C15H14ClN3O.C12H7ClN2O.C12H8N2O/c1-19(2)8-9-5-6-11-13-10(4-3-7-17-13)12(16)15(20)14(11)18-9;13-9-7-3-1-5-14-10(7)8-4-2-6-15-11(8)12(9)16;15-10-7-8-3-1-5-13-11(8)9-4-2-6-14-12(9)10/h3-7,20H,8H2,1-2H3;1-6,16H;1-7,15H |
| InChIKey | HGOGJNUELDRIQV-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 141.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.61 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|