C34H66O5Si2 — CID 15847289
3,7-dimethyloct-6-enyl 5-[[[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-dimethylsilyl]oxy-dimethylsilyl]pentanoate (PubChem CID 15847289) has the molecular formula C34H66O5Si2 and a molecular weight of 611.07 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 5-[[[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-dimethylsilyl]oxy-dimethylsilyl]pentanoate.
| Compound Name | 3,7-dimethyloct-6-enyl 5-[[[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-dimethylsilyl]oxy-dimethylsilyl]pentanoate |
|---|---|
| PubChem CID | 15847289 |
| Molecular Formula | C34H66O5Si2 |
| Molecular Weight | 611.07 g/mol |
| Exact Mass | 610.44 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 5-[[[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-dimethylsilyl]oxy-dimethylsilyl]pentanoate |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CCCC[Si](C)(C)O[Si](C)(C)CCCCC(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C34H66O5Si2/c1-29(2)17-15-19-31(5)23-25-37-33(35)21-11-13-27-40(7,8)39-41(9,10)28-14-12-22-34(36)38-26-24-32(6)20-16-18-30(3)4/h17-18,31-32H,11-16,19-28H2,1-10H3 |
| InChIKey | YQVUZHJLNFZTPV-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.07 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|