C6H12O10 — CID 158473512
hydrogen peroxide;2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate (PubChem CID 158473512) has the molecular formula C6H12O10 and a molecular weight of 244.15 g/mol. Its IUPAC name is hydrogen peroxide;2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate.
| Compound Name | hydrogen peroxide;2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
|---|---|
| PubChem CID | 158473512 |
| Molecular Formula | C6H12O10 |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | hydrogen peroxide;2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
| SMILES | O.O=C(O)CC(O)(CC(=O)O)C(=O)O.OO |
| InChI | InChI=1S/C6H8O7.H2O2.H2O/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-2;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-2H;1H2 |
| InChIKey | HGQITBIHNVFAIY-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 204.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|