About methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine
methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 158474492) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 158474492 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | C.COCC1C=CCN(C)C1 |
| InChI | InChI=1S/C8H15NO.CH4/c1-9-5-3-4-8(6-9)7-10-2;/h3-4,8H,5-7H2,1-2H3;1H4 |
| InChIKey | HGTNXVQRAAEHHV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine (CID 158474492) is methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine is C.COCC1C=CCN(C)C1.
What is the InChIKey of methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is HGTNXVQRAAEHHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.CH4/c1-9-5-3-4-8(6-9)7-10-2;/h3-4,8H,5-7H2,1-2H3;1H4.
What are the key properties of methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine?
methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 157.26 g/mol, XLogP of 1.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 158474492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).